C21H26N4O4S2 — CID 19678517
methyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (PubChem CID 19678517) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is methyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678517 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | methyl 2-[(3-acetamidophenyl)carbamothioylamino]-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=S)Nc2cccc(NC(C)=O)c2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C21H26N4O4S2/c1-6-25(7-2)19(27)17-12(3)16(20(28)29-5)18(31-17)24-21(30)23-15-10-8-9-14(11-15)22-13(4)26/h8-11H,6-7H2,1-5H3,(H,22,26)(H2,23,24,30) |
| InChIKey | RZOWKSRGODOPFT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|