C23H31N3O5S2 — CID 19675712
methyl 5-(diethylcarbamoyl)-2-[1-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-4-methylthiophene-3-carboxylate (PubChem CID 19675712) has the molecular formula C23H31N3O5S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is methyl 5-(diethylcarbamoyl)-2-[1-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-4-methylthiophene-3-carboxylate.
| Compound Name | methyl 5-(diethylcarbamoyl)-2-[1-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19675712 |
| Molecular Formula | C23H31N3O5S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | methyl 5-(diethylcarbamoyl)-2-[1-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-4-methylthiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=S)NC(C)c2ccc(OC)c(OC)c2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C23H31N3O5S2/c1-8-26(9-2)21(27)19-13(3)18(22(28)31-7)20(33-19)25-23(32)24-14(4)15-10-11-16(29-5)17(12-15)30-6/h10-12,14H,8-9H2,1-7H3,(H2,24,25,32) |
| InChIKey | SYWXPICVFUXTGW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|