C19H29N3O4S2 — CID 2954101
methyl 5-(diethylcarbamoyl)-4-methyl-2-[1-(oxolan-2-yl)ethylcarbamothioylamino]thiophene-3-carboxylate (PubChem CID 2954101) has the molecular formula C19H29N3O4S2 and a molecular weight of 427.59 g/mol. Its IUPAC name is methyl 5-(diethylcarbamoyl)-4-methyl-2-[1-(oxolan-2-yl)ethylcarbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-(diethylcarbamoyl)-4-methyl-2-[1-(oxolan-2-yl)ethylcarbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2954101 |
| Molecular Formula | C19H29N3O4S2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | methyl 5-(diethylcarbamoyl)-4-methyl-2-[1-(oxolan-2-yl)ethylcarbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCN(CC)C(=O)c1sc(NC(=S)NC(C)C2CCCO2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C19H29N3O4S2/c1-6-22(7-2)17(23)15-11(3)14(18(24)25-5)16(28-15)21-19(27)20-12(4)13-9-8-10-26-13/h12-13H,6-10H2,1-5H3,(H2,20,21,27) |
| InChIKey | CFLYHGGFLAMILV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|