C17H24N2O5S2 — CID 27522355
diethyl 3-methyl-5-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]thiophene-2,4-dicarboxylate (PubChem CID 27522355) has the molecular formula C17H24N2O5S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 27522355 |
| Molecular Formula | C17H24N2O5S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | diethyl 3-methyl-5-[[(2R)-oxolan-2-yl]methylcarbamothioylamino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC[C@H]2CCCO2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C17H24N2O5S2/c1-4-22-15(20)12-10(3)13(16(21)23-5-2)26-14(12)19-17(25)18-9-11-7-6-8-24-11/h11H,4-9H2,1-3H3,(H2,18,19,25)/t11-/m1/s1 |
| InChIKey | CYATVUPKCRWZMH-LLVKDONJSA-N |
| XLogP | 2.88 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|