C18H21N3O3S2 — CID 19678504
methyl 2-[(3-acetamidophenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 19678504) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is methyl 2-[(3-acetamidophenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-acetamidophenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678504 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | methyl 2-[(3-acetamidophenyl)carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)Nc2cccc(NC(C)=O)c2)c1C(=O)OC |
| InChI | InChI=1S/C18H21N3O3S2/c1-5-14-10(2)26-16(15(14)17(23)24-4)21-18(25)20-13-8-6-7-12(9-13)19-11(3)22/h6-9H,5H2,1-4H3,(H,19,22)(H2,20,21,25) |
| InChIKey | PPBRCCSGLMWESC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|