C26H33N3O4S3 — CID 19679153
methyl 2-[[4-(1-adamantylsulfamoyl)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 19679153) has the molecular formula C26H33N3O4S3 and a molecular weight of 547.77 g/mol. Its IUPAC name is methyl 2-[[4-(1-adamantylsulfamoyl)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[4-(1-adamantylsulfamoyl)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19679153 |
| Molecular Formula | C26H33N3O4S3 |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | methyl 2-[[4-(1-adamantylsulfamoyl)phenyl]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)Nc2ccc(S(=O)(=O)NC34CC5CC(CC(C5)C3)C4)cc2)c1C(=O)OC |
| InChI | InChI=1S/C26H33N3O4S3/c1-4-21-15(2)35-23(22(21)24(30)33-3)28-25(34)27-19-5-7-20(8-6-19)36(31,32)29-26-12-16-9-17(13-26)11-18(10-16)14-26/h5-8,16-18,29H,4,9-14H2,1-3H3,(H2,27,28,34) |
| InChIKey | UNLAEHVGNZRDOJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|