C23H25Cl2N3O2S2 — CID 19679104
1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2,5-dichlorophenyl)thiourea (PubChem CID 19679104) has the molecular formula C23H25Cl2N3O2S2 and a molecular weight of 510.51 g/mol. Its IUPAC name is 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2,5-dichlorophenyl)thiourea.
| Compound Name | 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2,5-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 19679104 |
| Molecular Formula | C23H25Cl2N3O2S2 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 509.08 |
| IUPAC Name | 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(2,5-dichlorophenyl)thiourea |
| SMILES | O=S(=O)(NC12CC3CC(CC(C3)C1)C2)c1ccc(NC(=S)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C23H25Cl2N3O2S2/c24-17-1-6-20(25)21(10-17)27-22(31)26-18-2-4-19(5-3-18)32(29,30)28-23-11-14-7-15(12-23)9-16(8-14)13-23/h1-6,10,14-16,28H,7-9,11-13H2,(H2,26,27,31) |
| InChIKey | OMGIYDHQMDJNKP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|