C27H29N3O4S2 — CID 19679150
1-[4-(1-adamantylsulfamoyl)phenyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea (PubChem CID 19679150) has the molecular formula C27H29N3O4S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea.
| Compound Name | 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea |
|---|---|
| PubChem CID | 19679150 |
| Molecular Formula | C27H29N3O4S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 1-[4-(1-adamantylsulfamoyl)phenyl]-3-(4-methyl-2-oxochromen-7-yl)thiourea |
| SMILES | Cc1cc(=O)oc2cc(NC(=S)Nc3ccc(S(=O)(=O)NC45CC6CC(CC(C6)C4)C5)cc3)ccc12 |
| InChI | InChI=1S/C27H29N3O4S2/c1-16-8-25(31)34-24-12-21(4-7-23(16)24)29-26(35)28-20-2-5-22(6-3-20)36(32,33)30-27-13-17-9-18(14-27)11-19(10-17)15-27/h2-8,12,17-19,30H,9-11,13-15H2,1H3,(H2,28,29,35) |
| InChIKey | ODUJOMFPNHRKHG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|