C23H26N2O5 — CID 72712579
[[2-(1-adamantyl)acetyl]amino] N-(4-methyl-2-oxochromen-7-yl)carbamate (PubChem CID 72712579) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [[2-(1-adamantyl)acetyl]amino] N-(4-methyl-2-oxochromen-7-yl)carbamate.
| Compound Name | [[2-(1-adamantyl)acetyl]amino] N-(4-methyl-2-oxochromen-7-yl)carbamate |
|---|---|
| PubChem CID | 72712579 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [[2-(1-adamantyl)acetyl]amino] N-(4-methyl-2-oxochromen-7-yl)carbamate |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)ONC(=O)CC34CC5CC(CC(C5)C3)C4)ccc12 |
| InChI | InChI=1S/C23H26N2O5/c1-13-4-21(27)29-19-8-17(2-3-18(13)19)24-22(28)30-25-20(26)12-23-9-14-5-15(10-23)7-16(6-14)11-23/h2-4,8,14-16H,5-7,9-12H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | NCUDUCYYLYHYDR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|