C17H21N3O3 — CID 134131876
N-(4-methyl-2-oxochromen-7-yl)-2-(piperidin-4-ylamino)acetamide (PubChem CID 134131876) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-(4-methyl-2-oxochromen-7-yl)-2-(piperidin-4-ylamino)acetamide.
| Compound Name | N-(4-methyl-2-oxochromen-7-yl)-2-(piperidin-4-ylamino)acetamide |
|---|---|
| PubChem CID | 134131876 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-(4-methyl-2-oxochromen-7-yl)-2-(piperidin-4-ylamino)acetamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CNC3CCNCC3)ccc12 |
| InChI | InChI=1S/C17H21N3O3/c1-11-8-17(22)23-15-9-13(2-3-14(11)15)20-16(21)10-19-12-4-6-18-7-5-12/h2-3,8-9,12,18-19H,4-7,10H2,1H3,(H,20,21) |
| InChIKey | FWZSYNOPNTZEAT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|