C18H22N2O5 — CID 53393956
N'-hydroxy-N-(4-methyl-2-oxochromen-7-yl)octanediamide (PubChem CID 53393956) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N'-hydroxy-N-(4-methyl-2-oxochromen-7-yl)octanediamide.
| Compound Name | N'-hydroxy-N-(4-methyl-2-oxochromen-7-yl)octanediamide |
|---|---|
| PubChem CID | 53393956 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N'-hydroxy-N-(4-methyl-2-oxochromen-7-yl)octanediamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)CCCCCCC(=O)NO)ccc12 |
| InChI | InChI=1S/C18H22N2O5/c1-12-10-18(23)25-15-11-13(8-9-14(12)15)19-16(21)6-4-2-3-5-7-17(22)20-24/h8-11,24H,2-7H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | YSRCADVJNRJJAV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|