C18H20F3NO3 — CID 89057127
N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]octanamide (PubChem CID 89057127) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]octanamide.
| Compound Name | N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]octanamide |
|---|---|
| PubChem CID | 89057127 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H20F3NO3/c1-2-3-4-5-6-7-16(23)22-12-8-9-13-14(18(19,20)21)11-17(24)25-15(13)10-12/h8-11H,2-7H2,1H3,(H,22,23) |
| InChIKey | PIYUERNOORCXAX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|