C12H9BrF3NO2 — CID 101175054
7-(2-bromoethylamino)-4-(trifluoromethyl)chromen-2-one (PubChem CID 101175054) has the molecular formula C12H9BrF3NO2 and a molecular weight of 336.11 g/mol. Its IUPAC name is 7-(2-bromoethylamino)-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-(2-bromoethylamino)-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 101175054 |
| Molecular Formula | C12H9BrF3NO2 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 7-(2-bromoethylamino)-4-(trifluoromethyl)chromen-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(NCCBr)cc2o1 |
| InChI | InChI=1S/C12H9BrF3NO2/c13-3-4-17-7-1-2-8-9(12(14,15)16)6-11(18)19-10(8)5-7/h1-2,5-6,17H,3-4H2 |
| InChIKey | BLWRIHVBGPSODH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|