C21H14F3NO2 — CID 101018477
7-(azulen-1-ylmethylamino)-4-(trifluoromethyl)chromen-2-one (PubChem CID 101018477) has the molecular formula C21H14F3NO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 7-(azulen-1-ylmethylamino)-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-(azulen-1-ylmethylamino)-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 101018477 |
| Molecular Formula | C21H14F3NO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 7-(azulen-1-ylmethylamino)-4-(trifluoromethyl)chromen-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(NCc3ccc4cccccc3-4)cc2o1 |
| InChI | InChI=1S/C21H14F3NO2/c22-21(23,24)18-11-20(26)27-19-10-15(8-9-17(18)19)25-12-14-7-6-13-4-2-1-3-5-16(13)14/h1-11,25H,12H2 |
| InChIKey | UKCPRDZLUNBZQV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|