C19H11F3N2O4 — CID 18083177
7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(trifluoromethyl)chromen-2-one (PubChem CID 18083177) has the molecular formula C19H11F3N2O4 and a molecular weight of 388.30 g/mol. Its IUPAC name is 7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 18083177 |
| Molecular Formula | C19H11F3N2O4 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 7-[(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]-4-(trifluoromethyl)chromen-2-one |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(OCc3nc(-c4ccccc4)no3)cc2o1 |
| InChI | InChI=1S/C19H11F3N2O4/c20-19(21,22)14-9-17(25)27-15-8-12(6-7-13(14)15)26-10-16-23-18(24-28-16)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | QOEGOOFWATZUAJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|