C26H19FN2O5 — CID 166375581
7-[[3-[2-fluoro-4-[3-(hydroxymethyl)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]methoxy]-4-methylchromen-2-one (PubChem CID 166375581) has the molecular formula C26H19FN2O5 and a molecular weight of 458.45 g/mol. Its IUPAC name is 7-[[3-[2-fluoro-4-[3-(hydroxymethyl)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[3-[2-fluoro-4-[3-(hydroxymethyl)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 166375581 |
| Molecular Formula | C26H19FN2O5 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 7-[[3-[2-fluoro-4-[3-(hydroxymethyl)phenyl]phenyl]-1,2,4-oxadiazol-5-yl]methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3nc(-c4ccc(-c5cccc(CO)c5)cc4F)no3)ccc12 |
| InChI | InChI=1S/C26H19FN2O5/c1-15-9-25(31)33-23-12-19(6-8-20(15)23)32-14-24-28-26(29-34-24)21-7-5-18(11-22(21)27)17-4-2-3-16(10-17)13-30/h2-12,30H,13-14H2,1H3 |
| InChIKey | IZUIVWOINZSPFH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|