C18H19NO4 — CID 47025690
7-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]-4-methylchromen-2-one (PubChem CID 47025690) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 7-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 47025690 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 7-[(5-tert-butyl-1,3-oxazol-2-yl)methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3ncc(C(C)(C)C)o3)ccc12 |
| InChI | InChI=1S/C18H19NO4/c1-11-7-17(20)22-14-8-12(5-6-13(11)14)21-10-16-19-9-15(23-16)18(2,3)4/h5-9H,10H2,1-4H3 |
| InChIKey | ZFDLASLGSYRZNP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|