C19H15BrO5 — CID 26000081
7-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-4-methylchromen-2-one (PubChem CID 26000081) has the molecular formula C19H15BrO5 and a molecular weight of 403.23 g/mol. Its IUPAC name is 7-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 26000081 |
| Molecular Formula | C19H15BrO5 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 7-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3cc4c(cc3Br)OCCO4)ccc12 |
| InChI | InChI=1S/C19H15BrO5/c1-11-6-19(21)25-16-8-13(2-3-14(11)16)24-10-12-7-17-18(9-15(12)20)23-5-4-22-17/h2-3,6-9H,4-5,10H2,1H3 |
| InChIKey | OLKRYGHBQCWFGB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|