C18H14O7S — CID 7510280
(4-methyl-2-oxochromen-7-yl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate (PubChem CID 7510280) has the molecular formula C18H14O7S and a molecular weight of 374.37 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate |
|---|---|
| PubChem CID | 7510280 |
| Molecular Formula | C18H14O7S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 2,3-dihydro-1,4-benzodioxine-6-sulfonate |
| SMILES | Cc1cc(=O)oc2cc(OS(=O)(=O)c3ccc4c(c3)OCCO4)ccc12 |
| InChI | InChI=1S/C18H14O7S/c1-11-8-18(19)24-16-9-12(2-4-14(11)16)25-26(20,21)13-3-5-15-17(10-13)23-7-6-22-15/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | GDPVSKMLCNQLIX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|