C20H16O5S — CID 18190635
(4-methyl-2-oxochromen-7-yl) 3,4-dihydronaphthalene-2-sulfonate (PubChem CID 18190635) has the molecular formula C20H16O5S and a molecular weight of 368.41 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 3,4-dihydronaphthalene-2-sulfonate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 3,4-dihydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 18190635 |
| Molecular Formula | C20H16O5S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 3,4-dihydronaphthalene-2-sulfonate |
| SMILES | Cc1cc(=O)oc2cc(OS(=O)(=O)C3=Cc4ccccc4CC3)ccc12 |
| InChI | InChI=1S/C20H16O5S/c1-13-10-20(21)24-19-12-16(7-9-18(13)19)25-26(22,23)17-8-6-14-4-2-3-5-15(14)11-17/h2-5,7,9-12H,6,8H2,1H3 |
| InChIKey | MJDHSOZIJFRQIA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|