C16H18O7 — CID 95401077
4-methyl-7-[(1R,2S,3R,4R,5R)-2,3,4,5-tetrahydroxycyclohexyl]oxychromen-2-one (PubChem CID 95401077) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-methyl-7-[(1R,2S,3R,4R,5R)-2,3,4,5-tetrahydroxycyclohexyl]oxychromen-2-one.
| Compound Name | 4-methyl-7-[(1R,2S,3R,4R,5R)-2,3,4,5-tetrahydroxycyclohexyl]oxychromen-2-one |
|---|---|
| PubChem CID | 95401077 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 4-methyl-7-[(1R,2S,3R,4R,5R)-2,3,4,5-tetrahydroxycyclohexyl]oxychromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H]3C[C@@H](O)[C@@H](O)[C@@H](O)[C@@H]3O)ccc12 |
| InChI | InChI=1S/C16H18O7/c1-7-4-13(18)23-11-5-8(2-3-9(7)11)22-12-6-10(17)14(19)16(21)15(12)20/h2-5,10,12,14-17,19-21H,6H2,1H3/t10-,12-,14-,15-,16-/m1/s1 |
| InChIKey | IMKMPQXQXHACFR-UTHQJWEXSA-N |
| XLogP | -0.30 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|