C16H18O6 — CID 167510863
7-[(2S,3S,4R,6S)-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4-methylchromen-2-one (PubChem CID 167510863) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 7-[(2S,3S,4R,6S)-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4-methylchromen-2-one.
| Compound Name | 7-[(2S,3S,4R,6S)-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 167510863 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 7-[(2S,3S,4R,6S)-3,4-dihydroxy-6-methyloxan-2-yl]oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H]3O[C@@H](C)C[C@@H](O)[C@@H]3O)ccc12 |
| InChI | InChI=1S/C16H18O6/c1-8-5-14(18)22-13-7-10(3-4-11(8)13)21-16-15(19)12(17)6-9(2)20-16/h3-5,7,9,12,15-17,19H,6H2,1-2H3/t9-,12+,15-,16-/m0/s1 |
| InChIKey | PUFHBSUYCNHLHE-MTWJSSBXSA-N |
| XLogP | 1.34 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|