C15H17O10P — CID 10643963
[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]phosphonic acid (PubChem CID 10643963) has the molecular formula C15H17O10P and a molecular weight of 388.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]phosphonic acid.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 10643963 |
| Molecular Formula | C15H17O10P |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-2-yl]phosphonic acid |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H]3O[C@H](P(=O)(O)O)[C@@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C15H17O10P/c1-6-4-10(16)24-9-5-7(2-3-8(6)9)23-14-12(18)11(17)13(19)15(25-14)26(20,21)22/h2-5,11-15,17-19H,1H3,(H2,20,21,22)/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | LNDZSRVOTGPEOH-UXXRCYHCSA-N |
| XLogP | -0.58 |
| TPSA | 166.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|