C17H20O6 — CID 167510910
7-[(2S,3R,4S,6S)-3-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-4-methylchromen-2-one (PubChem CID 167510910) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 7-[(2S,3R,4S,6S)-3-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-4-methylchromen-2-one.
| Compound Name | 7-[(2S,3R,4S,6S)-3-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 167510910 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 7-[(2S,3R,4S,6S)-3-hydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O[C@@H]3O[C@H](CO)C[C@H](C)[C@H]3O)ccc12 |
| InChI | InChI=1S/C17H20O6/c1-9-6-15(19)23-14-7-11(3-4-13(9)14)21-17-16(20)10(2)5-12(8-18)22-17/h3-4,6-7,10,12,16-18,20H,5,8H2,1-2H3/t10-,12-,16+,17+/m0/s1 |
| InChIKey | LDPGWICBRVNALE-QMYPXSFVSA-N |
| XLogP | 1.58 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|