C21H24O8 — CID 170274597
[(2S,3R,4R,5S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-4-yl] acetate (PubChem CID 170274597) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,5S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 170274597 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-5-acetyloxy-2,3-dimethyl-6-(4-methyl-2-oxochromen-7-yl)oxyoxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](Oc2ccc3c(C)cc(=O)oc3c2)O[C@@H](C)[C@@H](C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24O8/c1-10-8-18(24)29-17-9-15(6-7-16(10)17)28-21-20(27-14(5)23)19(26-13(4)22)11(2)12(3)25-21/h6-9,11-12,19-21H,1-5H3/t11-,12+,19-,20+,21+/m1/s1 |
| InChIKey | POZCWJNCSNKRCD-OJNLCCNLSA-N |
| XLogP | 2.72 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|