C23H24O12 — CID 131700676
methyl (3S,6S)-3,4,5-triacetyloxy-6-(4-methyl-2-oxochromen-6-yl)oxyoxane-2-carboxylate (PubChem CID 131700676) has the molecular formula C23H24O12 and a molecular weight of 492.43 g/mol. Its IUPAC name is methyl (3S,6S)-3,4,5-triacetyloxy-6-(4-methyl-2-oxochromen-6-yl)oxyoxane-2-carboxylate.
| Compound Name | methyl (3S,6S)-3,4,5-triacetyloxy-6-(4-methyl-2-oxochromen-6-yl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 131700676 |
| Molecular Formula | C23H24O12 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | methyl (3S,6S)-3,4,5-triacetyloxy-6-(4-methyl-2-oxochromen-6-yl)oxyoxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@@H](Oc2ccc3oc(=O)cc(C)c3c2)C(OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H24O12/c1-10-8-17(27)34-16-7-6-14(9-15(10)16)33-23-21(32-13(4)26)19(31-12(3)25)18(30-11(2)24)20(35-23)22(28)29-5/h6-9,18-21,23H,1-5H3/t18-,19?,20?,21?,23+/m0/s1 |
| InChIKey | HZBVEPRBVYSPPX-PWWCDPQYSA-N |
| XLogP | 1.17 |
| TPSA | 153.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|