C43H44O13Si — CID 171382399
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[2,2-dimethylpropyl(diphenyl)silyl]oxy-6-oxobenzo[c]chromen-8-yl]oxyoxane-2-carboxylate (PubChem CID 171382399) has the molecular formula C43H44O13Si and a molecular weight of 796.90 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[2,2-dimethylpropyl(diphenyl)silyl]oxy-6-oxobenzo[c]chromen-8-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[2,2-dimethylpropyl(diphenyl)silyl]oxy-6-oxobenzo[c]chromen-8-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 171382399 |
| Molecular Formula | C43H44O13Si |
| Molecular Weight | 796.90 g/mol |
| Exact Mass | 796.26 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[2,2-dimethylpropyl(diphenyl)silyl]oxy-6-oxobenzo[c]chromen-8-yl]oxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc3c(c2)c(=O)oc2cc(O[Si](CC(C)(C)C)(c4ccccc4)c4ccccc4)ccc23)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C43H44O13Si/c1-25(44)50-36-37(51-26(2)45)39(52-27(3)46)42(55-38(36)41(48)49-7)53-28-18-20-32-33-21-19-29(23-35(33)54-40(47)34(32)22-28)56-57(24-43(4,5)6,30-14-10-8-11-15-30)31-16-12-9-13-17-31/h8-23,36-39,42H,24H2,1-7H3/t36-,37-,38-,39+,42+/m0/s1 |
| InChIKey | KQVUZEHBRBUEPR-UGOVMYJZSA-N |
| XLogP | 5.20 |
| TPSA | 163.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|