C50H68O15Si — CID 15834366
methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(10-acetyloxydecyl)-4-[tert-butyl(diphenyl)silyl]oxy-5,6-dimethoxy-3-methylphenoxy]oxane-2-carboxylate (PubChem CID 15834366) has the molecular formula C50H68O15Si and a molecular weight of 937.16 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(10-acetyloxydecyl)-4-[tert-butyl(diphenyl)silyl]oxy-5,6-dimethoxy-3-methylphenoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(10-acetyloxydecyl)-4-[tert-butyl(diphenyl)silyl]oxy-5,6-dimethoxy-3-methylphenoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 15834366 |
| Molecular Formula | C50H68O15Si |
| Molecular Weight | 937.16 g/mol |
| Exact Mass | 936.43 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(10-acetyloxydecyl)-4-[tert-butyl(diphenyl)silyl]oxy-5,6-dimethoxy-3-methylphenoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2c(CCCCCCCCCCOC(C)=O)c(C)c(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c(OC)c2OC)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C50H68O15Si/c1-32-39(30-24-16-14-12-13-15-17-25-31-59-33(2)51)41(63-49-47(62-36(5)54)45(61-35(4)53)44(60-34(3)52)46(64-49)48(55)58-11)43(57-10)42(56-9)40(32)65-66(50(6,7)8,37-26-20-18-21-27-37)38-28-22-19-23-29-38/h18-23,26-29,44-47,49H,12-17,24-25,30-31H2,1-11H3/t44-,45-,46-,47+,49+/m0/s1 |
| InChIKey | MLUUBWCFYZDIMV-OHYNIZKRSA-N |
| XLogP | 7.25 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.16 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|