C27H32O6Si — CID 140772716
[(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethynyloxolan-3-yl] acetate (PubChem CID 140772716) has the molecular formula C27H32O6Si and a molecular weight of 480.63 g/mol. Its IUPAC name is [(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethynyloxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethynyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 140772716 |
| Molecular Formula | C27H32O6Si |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | [(3R,4R,5S)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethynyloxolan-3-yl] acetate |
| SMILES | C#C[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H32O6Si/c1-7-23-24(33-26(32-20(3)29)25(23)31-19(2)28)18-30-34(27(4,5)6,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h1,8-17,23-26H,18H2,2-6H3/t23-,24-,25-,26?/m1/s1 |
| InChIKey | YFFFIVDOBUQDSY-NITSXXPLSA-N |
| XLogP | 3.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|