C33H39N3O7Si — CID 101108425
[(3R,4R,5R)-2-acetyloxy-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylmethoxyoxolan-3-yl] acetate (PubChem CID 101108425) has the molecular formula C33H39N3O7Si and a molecular weight of 617.78 g/mol. Its IUPAC name is [(3R,4R,5R)-2-acetyloxy-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylmethoxyoxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5R)-2-acetyloxy-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylmethoxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 101108425 |
| Molecular Formula | C33H39N3O7Si |
| Molecular Weight | 617.78 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | [(3R,4R,5R)-2-acetyloxy-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-phenylmethoxyoxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H]([C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H39N3O7Si/c1-23(37)41-31-30(39-21-25-15-9-6-10-16-25)29(43-32(31)42-24(2)38)28(35-36-34)22-40-44(33(3,4)5,26-17-11-7-12-18-26)27-19-13-8-14-20-27/h6-20,28-32H,21-22H2,1-5H3/t28-,29-,30-,31-,32?/m1/s1 |
| InChIKey | QVJLXJBBZIXOJW-FTTFCUNYSA-N |
| XLogP | 5.05 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|