C34H39N5O6Si — CID 10532186
1-[(2R,3R,4S,5R)-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10532186) has the molecular formula C34H39N5O6Si and a molecular weight of 641.80 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10532186 |
| Molecular Formula | C34H39N5O6Si |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-5-[(1R)-1-azido-2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-hydroxy-4-phenylmethoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H]([C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N=[N+]=[N-])[C@@H](OCc3ccccc3)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C34H39N5O6Si/c1-23-20-39(33(42)36-31(23)41)32-28(40)30(43-21-24-14-8-5-9-15-24)29(45-32)27(37-38-35)22-44-46(34(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-20,27-30,32,40H,21-22H2,1-4H3,(H,36,41,42)/t27-,28-,29-,30+,32-/m1/s1 |
| InChIKey | DRHUESFLCFZGGV-HXIBSYTNSA-N |
| XLogP | 3.94 |
| TPSA | 151.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|