C28H36N2O7PSi+ — CID 146032686
[(2S,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methyl-hydroxy-oxophosphanium (PubChem CID 146032686) has the molecular formula C28H36N2O7PSi+ and a molecular weight of 571.66 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methyl-hydroxy-oxophosphanium.
| Compound Name | [(2S,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methyl-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 146032686 |
| Molecular Formula | C28H36N2O7PSi+ |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | [(2S,3R,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methoxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methyl-hydroxy-oxophosphanium |
| SMILES | CO[C@@H]1[C@H](C[P+](=O)O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H35N2O7PSi/c1-19-16-30(27(32)29-25(19)31)26-24(35-5)22(18-38(33)34)23(37-26)17-36-39(28(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,22-24,26H,17-18H2,1-5H3,(H-,29,31,32,33,34)/p+1/t22-,23-,24-,26-/m1/s1 |
| InChIKey | QNQUPVCUHVWZBP-PMHJDTQVSA-O |
| XLogP | 2.68 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|