C30H39N3O7Si — CID 175585422
3-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-methylpropanamide (PubChem CID 175585422) has the molecular formula C30H39N3O7Si and a molecular weight of 581.74 g/mol. Its IUPAC name is 3-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-methylpropanamide.
| Compound Name | 3-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-methylpropanamide |
|---|---|
| PubChem CID | 175585422 |
| Molecular Formula | C30H39N3O7Si |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 3-[(2R,3R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxy-N-methylpropanamide |
| SMILES | CNC(=O)CCO[C@@H]1[C@@H](O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C30H39N3O7Si/c1-20-18-33(29(37)32-27(20)36)28-26(38-17-16-24(34)31-5)25(35)23(40-28)19-39-41(30(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,18,23,25-26,28,35H,16-17,19H2,1-5H3,(H,31,34)(H,32,36,37)/t23-,25+,26-,28-/m1/s1 |
| InChIKey | ZZFWOJKARYMFGO-REEOSCTQSA-N |
| XLogP | 1.20 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|