C35H52N2O7Si2 — CID 169083489
1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 169083489) has the molecular formula C35H52N2O7Si2 and a molecular weight of 668.98 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169083489 |
| Molecular Formula | C35H52N2O7Si2 |
| Molecular Weight | 668.98 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(3-hydroxypropoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OCCCO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C35H52N2O7Si2/c1-25-23-37(33(40)36-31(25)39)32-30(41-22-16-21-38)29(44-45(8,9)34(2,3)4)28(43-32)24-42-46(35(5,6)7,26-17-12-10-13-18-26)27-19-14-11-15-20-27/h10-15,17-20,23,28-30,32,38H,16,21-22,24H2,1-9H3,(H,36,39,40)/t28-,29-,30-,32-/m1/s1 |
| InChIKey | IJZGNNZXBYVHJM-PBAMLIMUSA-N |
| XLogP | 4.48 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.98 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|