C40H42N2O7Si — CID 122225769
[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] benzoate (PubChem CID 122225769) has the molecular formula C40H42N2O7Si and a molecular weight of 690.87 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 122225769 |
| Molecular Formula | C40H42N2O7Si |
| Molecular Weight | 690.87 g/mol |
| Exact Mass | 690.28 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-phenylmethoxyoxolan-3-yl] benzoate |
| SMILES | Cc1cn([C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H](OCc3ccccc3)[C@H]2OC(=O)c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C40H42N2O7Si/c1-28-25-42(39(45)41-36(28)43)37-35(49-38(44)30-19-11-6-12-20-30)34(46-26-29-17-9-5-10-18-29)33(48-37)27-47-50(40(2,3)4,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h5-25,33-35,37H,26-27H2,1-4H3,(H,41,43,45)/t33-,34-,35-,37-/m1/s1 |
| InChIKey | JRALCSANXOWSLG-OEPYUYADSA-N |
| XLogP | 5.13 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.87 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|