C44H46O7Si — CID 58940425
[(3R,4R,7S)-2-benzoyloxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxyoxepan-3-yl] benzoate (PubChem CID 58940425) has the molecular formula C44H46O7Si and a molecular weight of 714.93 g/mol. Its IUPAC name is [(3R,4R,7S)-2-benzoyloxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxyoxepan-3-yl] benzoate.
| Compound Name | [(3R,4R,7S)-2-benzoyloxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxyoxepan-3-yl] benzoate |
|---|---|
| PubChem CID | 58940425 |
| Molecular Formula | C44H46O7Si |
| Molecular Weight | 714.93 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | [(3R,4R,7S)-2-benzoyloxy-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-phenylmethoxyoxepan-3-yl] benzoate |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[C@@H](OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H46O7Si/c1-44(2,3)52(37-25-15-7-16-26-37,38-27-17-8-18-28-38)48-32-36-29-30-39(47-31-33-19-9-4-10-20-33)40(50-41(45)34-21-11-5-12-22-34)43(49-36)51-42(46)35-23-13-6-14-24-35/h4-28,36,39-40,43H,29-32H2,1-3H3/t36-,39+,40+,43?/m0/s1 |
| InChIKey | DQCYNQVDCBNQBT-LOEYYVOMSA-N |
| XLogP | 7.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.93 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|