C29H34O6Si — CID 166444221
[(3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methoxyoxolan-3-yl] benzoate (PubChem CID 166444221) has the molecular formula C29H34O6Si and a molecular weight of 506.67 g/mol. Its IUPAC name is [(3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methoxyoxolan-3-yl] benzoate.
| Compound Name | [(3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 166444221 |
| Molecular Formula | C29H34O6Si |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(3S,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-2-methoxyoxolan-3-yl] benzoate |
| SMILES | COC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34O6Si/c1-29(2,3)36(22-16-10-6-11-17-22,23-18-12-7-13-19-23)33-20-24-25(30)26(28(32-4)34-24)35-27(31)21-14-8-5-9-15-21/h5-19,24-26,28,30H,20H2,1-4H3/t24-,25-,26+,28?/m1/s1 |
| InChIKey | VXRAQWFHKZRTCM-OCYUSGCXSA-N |
| XLogP | 3.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|