C38H43NO6Si — CID 70877961
[(4R,5S)-3-acetamido-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-4-yl] benzoate (PubChem CID 70877961) has the molecular formula C38H43NO6Si and a molecular weight of 637.85 g/mol. Its IUPAC name is [(4R,5S)-3-acetamido-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-4-yl] benzoate.
| Compound Name | [(4R,5S)-3-acetamido-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 70877961 |
| Molecular Formula | C38H43NO6Si |
| Molecular Weight | 637.85 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | [(4R,5S)-3-acetamido-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hydroxyoxan-4-yl] benzoate |
| SMILES | CC(=O)NC1C(Cc2ccccc2)OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H43NO6Si/c1-27(40)39-34-32(25-28-17-9-5-10-18-28)44-33(35(41)36(34)45-37(42)29-19-11-6-12-20-29)26-43-46(38(2,3)4,30-21-13-7-14-22-30)31-23-15-8-16-24-31/h5-24,32-36,41H,25-26H2,1-4H3,(H,39,40)/t32?,33?,34?,35-,36-/m1/s1 |
| InChIKey | QTWSRSNNBCJVIT-QMNYOUGWSA-N |
| XLogP | 4.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.85 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|