C27H37NO5Si — CID 11518669
N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-prop-2-enyloxan-3-yl]acetamide (PubChem CID 11518669) has the molecular formula C27H37NO5Si and a molecular weight of 483.68 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-prop-2-enyloxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-prop-2-enyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 11518669 |
| Molecular Formula | C27H37NO5Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxy-2-prop-2-enyloxan-3-yl]acetamide |
| SMILES | C=CC[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C27H37NO5Si/c1-6-13-22-24(28-19(2)29)26(31)25(30)23(33-22)18-32-34(27(3,4)5,20-14-9-7-10-15-20)21-16-11-8-12-17-21/h6-12,14-17,22-26,30-31H,1,13,18H2,2-5H3,(H,28,29)/t22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | OGYNTHFFFGGXPL-PUHDZGQXSA-N |
| XLogP | 2.13 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|