C24H30F3NO6Si — CID 171126171
N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4,5-trihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 171126171) has the molecular formula C24H30F3NO6Si and a molecular weight of 513.59 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4,5-trihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4,5-trihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 171126171 |
| Molecular Formula | C24H30F3NO6Si |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4,5-trihydroxyoxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](O)[C@H](NC(=O)C(F)(F)F)[C@@H](O)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30F3NO6Si/c1-23(2,3)35(15-10-6-4-7-11-15,16-12-8-5-9-13-16)33-14-17-19(29)20(30)18(21(31)34-17)28-22(32)24(25,26)27/h4-13,17-21,29-31H,14H2,1-3H3,(H,28,32)/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | ZMMCILRIUYLRDM-ONUIULTDSA-N |
| XLogP | 1.05 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|