C28H34O6Si — CID 134846505
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenoxyoxane-3,4,5-triol (PubChem CID 134846505) has the molecular formula C28H34O6Si and a molecular weight of 494.66 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenoxyoxane-3,4,5-triol.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 134846505 |
| Molecular Formula | C28H34O6Si |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenoxyoxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](OCC1OC(Oc2ccccc2)C(O)C(O)C1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O6Si/c1-28(2,3)35(21-15-9-5-10-16-21,22-17-11-6-12-18-22)32-19-23-24(29)25(30)26(31)27(34-23)33-20-13-7-4-8-14-20/h4-18,23-27,29-31H,19H2,1-3H3 |
| InChIKey | DIOUWBSVRBYLMK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|