C28H33IO6Si — CID 134846501
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-iodophenoxy)oxane-3,4,5-triol (PubChem CID 134846501) has the molecular formula C28H33IO6Si and a molecular weight of 620.56 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-iodophenoxy)oxane-3,4,5-triol.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-iodophenoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134846501 |
| Molecular Formula | C28H33IO6Si |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-iodophenoxy)oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](OCC1OC(Oc2ccc(I)cc2)C(O)C(O)C1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H33IO6Si/c1-28(2,3)36(21-10-6-4-7-11-21,22-12-8-5-9-13-22)33-18-23-24(30)25(31)26(32)27(35-23)34-20-16-14-19(29)15-17-20/h4-17,23-27,30-32H,18H2,1-3H3 |
| InChIKey | XZXOAADKWIHHAQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|