C25H36O4Si — CID 10938882
(2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-3,5-dimethyloxan-4-ol (PubChem CID 10938882) has the molecular formula C25H36O4Si and a molecular weight of 428.65 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-3,5-dimethyloxan-4-ol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-3,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 10938882 |
| Molecular Formula | C25H36O4Si |
| Molecular Weight | 428.65 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-3,5-dimethyloxan-4-ol |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C25H36O4Si/c1-18-22(29-24(27-6)19(2)23(18)26)17-28-30(25(3,4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,18-19,22-24,26H,17H2,1-6H3/t18-,19+,22+,23+,24-/m0/s1 |
| InChIKey | CAXLVPPDYFBTSD-CQRLQNNPSA-N |
| XLogP | 3.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|