C26H39NO6Si — CID 167659954
6-(3-amino-2-hydroxypropoxy)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxane-3,4-diol (PubChem CID 167659954) has the molecular formula C26H39NO6Si and a molecular weight of 489.69 g/mol. Its IUPAC name is 6-(3-amino-2-hydroxypropoxy)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxane-3,4-diol.
| Compound Name | 6-(3-amino-2-hydroxypropoxy)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 167659954 |
| Molecular Formula | C26H39NO6Si |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 6-(3-amino-2-hydroxypropoxy)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxane-3,4-diol |
| SMILES | CC1C(OCC(O)CN)OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(O)C1O |
| InChI | InChI=1S/C26H39NO6Si/c1-18-23(29)24(30)22(33-25(18)31-16-19(28)15-27)17-32-34(26(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19,22-25,28-30H,15-17,27H2,1-4H3 |
| InChIKey | WMJLMXYCDGIXSZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|