C24H35NO5Si — CID 175906999
(2R,3R,4R,5R)-4-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(dimethoxymethyl)oxolan-3-ol (PubChem CID 175906999) has the molecular formula C24H35NO5Si and a molecular weight of 445.63 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(dimethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-4-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(dimethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 175906999 |
| Molecular Formula | C24H35NO5Si |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (2R,3R,4R,5R)-4-amino-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(dimethoxymethyl)oxolan-3-ol |
| SMILES | COC(OC)[C@@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](N)[C@H]1O |
| InChI | InChI=1S/C24H35NO5Si/c1-24(2,3)31(17-12-8-6-9-13-17,18-14-10-7-11-15-18)29-16-19-20(25)21(26)22(30-19)23(27-4)28-5/h6-15,19-23,26H,16,25H2,1-5H3/t19-,20-,21+,22+/m0/s1 |
| InChIKey | BZHMFGABYTYBTG-FNAHDJPLSA-N |
| XLogP | 1.64 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|