C22H28O4Si — CID 99774565
(2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 99774565) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is (2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 99774565 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2S,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1OC=C[C@@H](O)[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O4Si/c1-22(2,3)27(17-10-6-4-7-11-17,18-12-8-5-9-13-18)26-16-20-21(24)19(23)14-15-25-20/h4-15,19-21,23-24H,16H2,1-3H3/t19-,20+,21-/m1/s1 |
| InChIKey | HIVBZUOTQALJIU-QHAWAJNXSA-N |
| XLogP | 2.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|