C29H34O4Si — CID 177419468
(2R,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 177419468) has the molecular formula C29H34O4Si and a molecular weight of 474.67 g/mol. Its IUPAC name is (2R,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 177419468 |
| Molecular Formula | C29H34O4Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (2R,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-phenylmethoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](OCc2ccccc2)C=C[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34O4Si/c1-29(2,3)34(24-15-9-5-10-16-24,25-17-11-6-12-18-25)32-22-27-26(30)19-20-28(33-27)31-21-23-13-7-4-8-14-23/h4-20,26-28,30H,21-22H2,1-3H3/t26-,27-,28-/m1/s1 |
| InChIKey | RPZFMESDQJXBAW-JCYYIGJDSA-N |
| XLogP | 4.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|