C34H38O4Si — CID 142503970
tert-butyl-diphenyl-[[(4R,5R)-2-phenyl-5-phenylmethoxy-1,3-dioxan-4-yl]methoxy]silane (PubChem CID 142503970) has the molecular formula C34H38O4Si and a molecular weight of 538.76 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(4R,5R)-2-phenyl-5-phenylmethoxy-1,3-dioxan-4-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(4R,5R)-2-phenyl-5-phenylmethoxy-1,3-dioxan-4-yl]methoxy]silane |
|---|---|
| PubChem CID | 142503970 |
| Molecular Formula | C34H38O4Si |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | tert-butyl-diphenyl-[[(4R,5R)-2-phenyl-5-phenylmethoxy-1,3-dioxan-4-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(c2ccccc2)OC[C@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38O4Si/c1-34(2,3)39(29-20-12-6-13-21-29,30-22-14-7-15-23-30)37-26-32-31(35-24-27-16-8-4-9-17-27)25-36-33(38-32)28-18-10-5-11-19-28/h4-23,31-33H,24-26H2,1-3H3/t31-,32-,33?/m1/s1 |
| InChIKey | RCTDICUHQUTBKC-NWBPNMJXSA-N |
| XLogP | 6.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|