C29H35NO3Si — CID 101261245
(5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxypiperidin-2-one (PubChem CID 101261245) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is (5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxypiperidin-2-one.
| Compound Name | (5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxypiperidin-2-one |
|---|---|
| PubChem CID | 101261245 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | (5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-phenylmethoxypiperidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1NC(=O)CC[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO3Si/c1-29(2,3)34(24-15-9-5-10-16-24,25-17-11-6-12-18-25)33-22-26-27(19-20-28(31)30-26)32-21-23-13-7-4-8-14-23/h4-18,26-27H,19-22H2,1-3H3,(H,30,31)/t26-,27+/m1/s1 |
| InChIKey | YKVDEKXHARNWNU-SXOMAYOGSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|