C51H64N2O5Si — CID 91197904
benzyl (2S,3R)-2-(dibenzylamino)-6-hydroxy-3-methylhexanoate;(5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpiperidin-2-one (PubChem CID 91197904) has the molecular formula C51H64N2O5Si and a molecular weight of 813.17 g/mol. Its IUPAC name is benzyl (2S,3R)-2-(dibenzylamino)-6-hydroxy-3-methylhexanoate;(5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpiperidin-2-one.
| Compound Name | benzyl (2S,3R)-2-(dibenzylamino)-6-hydroxy-3-methylhexanoate;(5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpiperidin-2-one |
|---|---|
| PubChem CID | 91197904 |
| Molecular Formula | C51H64N2O5Si |
| Molecular Weight | 813.17 g/mol |
| Exact Mass | 812.46 |
| IUPAC Name | benzyl (2S,3R)-2-(dibenzylamino)-6-hydroxy-3-methylhexanoate;(5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methylpiperidin-2-one |
| SMILES | C[C@@H]1CCC(=O)N[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.C[C@H](CCCO)[C@@H](C(=O)OCc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H33NO3.C23H31NO2Si/c1-23(12-11-19-30)27(28(31)32-22-26-17-9-4-10-18-26)29(20-24-13-5-2-6-14-24)21-25-15-7-3-8-16-25;1-18-15-16-22(25)24-21(18)17-26-27(23(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h2-10,13-18,23,27,30H,11-12,19-22H2,1H3;5-14,18,21H,15-17H2,1-4H3,(H,24,25)/t23-,27+;18-,21+/m11/s1 |
| InChIKey | CGYVXODYJRURIW-SRMLBPJZSA-N |
| XLogP | 8.69 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.17 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|